C11H19NO20S3 — CID 171124422
(2R,3S,4R,5S,6S)-6-[(2S,3R,4R,5R,6R)-4,6-dihydroxy-5-(sulfoamino)-2-sulfooxyoxan-3-yl]oxy-3,4-dihydroxy-5-sulfooxyoxane-2-carboxylic acid (PubChem CID 171124422) has the molecular formula C11H19NO20S3 and a molecular weight of 581.46 g/mol. Its IUPAC name is (2R,3S,4R,5S,6S)-6-[(2S,3R,4R,5R,6R)-4,6-dihydroxy-5-(sulfoamino)-2-sulfooxyoxan-3-yl]oxy-3,4-dihydroxy-5-sulfooxyoxane-2-carboxylic acid.
| Compound Name | (2R,3S,4R,5S,6S)-6-[(2S,3R,4R,5R,6R)-4,6-dihydroxy-5-(sulfoamino)-2-sulfooxyoxan-3-yl]oxy-3,4-dihydroxy-5-sulfooxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 171124422 |
| Molecular Formula | C11H19NO20S3 |
| Molecular Weight | 581.46 g/mol |
| Exact Mass | 580.97 |
| IUPAC Name | (2R,3S,4R,5S,6S)-6-[(2S,3R,4R,5R,6R)-4,6-dihydroxy-5-(sulfoamino)-2-sulfooxyoxan-3-yl]oxy-3,4-dihydroxy-5-sulfooxyoxane-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1O[C@H](O[C@H]2[C@H](OS(=O)(=O)O)O[C@@H](O)[C@H](NS(=O)(=O)O)[C@H]2O)[C@@H](OS(=O)(=O)O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H19NO20S3/c13-2-1(12-33(19,20)21)9(18)30-11(32-35(25,26)27)6(2)29-10-7(31-34(22,23)24)4(15)3(14)5(28-10)8(16)17/h1-7,9-15,18H,(H,16,17)(H,19,20,21)(H,22,23,24)(H,25,26,27)/t1-,2-,3+,4-,5-,6-,7+,9-,10-,11+/m1/s1 |
| InChIKey | QJTSAMCFOXOBJU-BYDJGBRZSA-N |
| XLogP | -6.29 |
| TPSA | 339.51 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.46 |
| LogP ≤ 5 | -6.29 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|