C9H16O8 — CID 171124876
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[(2S,3S)-3-hydroxyoxiran-2-yl]methoxy]oxane-3,4,5-triol (PubChem CID 171124876) has the molecular formula C9H16O8 and a molecular weight of 252.22 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[(2S,3S)-3-hydroxyoxiran-2-yl]methoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[(2S,3S)-3-hydroxyoxiran-2-yl]methoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 171124876 |
| Molecular Formula | C9H16O8 |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[(2S,3S)-3-hydroxyoxiran-2-yl]methoxy]oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@H](OC[C@@H]2O[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H16O8/c10-1-3-5(11)6(12)7(13)9(17-3)15-2-4-8(14)16-4/h3-14H,1-2H2/t3-,4+,5-,6+,7-,8+,9+/m1/s1 |
| InChIKey | NFQXLXQLSJWKSP-BGLKIOTKSA-N |
| XLogP | -3.48 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | -3.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|