C39H35N3O9 — CID 171125523
[(2R,3R,4S,5S,6S)-6-hydroxy-2-(hydroxymethyl)-4,5-bis[(2-phenylphenyl)carbamoyloxy]oxan-3-yl] N-phenylcarbamate (PubChem CID 171125523) has the molecular formula C39H35N3O9 and a molecular weight of 689.72 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-6-hydroxy-2-(hydroxymethyl)-4,5-bis[(2-phenylphenyl)carbamoyloxy]oxan-3-yl] N-phenylcarbamate.
| Compound Name | [(2R,3R,4S,5S,6S)-6-hydroxy-2-(hydroxymethyl)-4,5-bis[(2-phenylphenyl)carbamoyloxy]oxan-3-yl] N-phenylcarbamate |
|---|---|
| PubChem CID | 171125523 |
| Molecular Formula | C39H35N3O9 |
| Molecular Weight | 689.72 g/mol |
| Exact Mass | 689.24 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-6-hydroxy-2-(hydroxymethyl)-4,5-bis[(2-phenylphenyl)carbamoyloxy]oxan-3-yl] N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1-c1ccccc1)O[C@@H]1[C@H](OC(=O)Nc2ccccc2-c2ccccc2)[C@@H](O)O[C@H](CO)[C@H]1OC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C39H35N3O9/c43-24-32-33(49-37(45)40-27-18-8-3-9-19-27)34(50-38(46)41-30-22-12-10-20-28(30)25-14-4-1-5-15-25)35(36(44)48-32)51-39(47)42-31-23-13-11-21-29(31)26-16-6-2-7-17-26/h1-23,32-36,43-44H,24H2,(H,40,45)(H,41,46)(H,42,47)/t32-,33-,34+,35+,36+/m1/s1 |
| InChIKey | XYWLLPBKJMBCSG-DKQOGILZSA-N |
| XLogP | 6.88 |
| TPSA | 164.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.72 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|