C16H18O8 — CID 171126233
[(3R,3aS,6R,6aR)-3-hydroxy-6-(6-methoxy-1,3-benzodioxol-5-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan-3a-yl] acetate (PubChem CID 171126233) has the molecular formula C16H18O8 and a molecular weight of 338.31 g/mol. Its IUPAC name is [(3R,3aS,6R,6aR)-3-hydroxy-6-(6-methoxy-1,3-benzodioxol-5-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan-3a-yl] acetate.
| Compound Name | [(3R,3aS,6R,6aR)-3-hydroxy-6-(6-methoxy-1,3-benzodioxol-5-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan-3a-yl] acetate |
|---|---|
| PubChem CID | 171126233 |
| Molecular Formula | C16H18O8 |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | [(3R,3aS,6R,6aR)-3-hydroxy-6-(6-methoxy-1,3-benzodioxol-5-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan-3a-yl] acetate |
| SMILES | COc1cc2c(cc1[C@@H]1OC[C@]3(OC(C)=O)[C@H](O)OC[C@H]13)OCO2 |
| InChI | InChI=1S/C16H18O8/c1-8(17)24-16-6-21-14(10(16)5-20-15(16)18)9-3-12-13(23-7-22-12)4-11(9)19-2/h3-4,10,14-15,18H,5-7H2,1-2H3/t10-,14+,15-,16-/m1/s1 |
| InChIKey | KUNVADATZSDYBJ-CXOGBFNASA-N |
| XLogP | 0.76 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |