C8H6N2OS2 — CID 171127509
(5E)-2-imino-5-(thiophen-3-ylmethylidene)-1,3-thiazolidin-4-one (PubChem CID 171127509) has the molecular formula C8H6N2OS2 and a molecular weight of 210.28 g/mol. Its IUPAC name is (5E)-2-imino-5-(thiophen-3-ylmethylidene)-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-imino-5-(thiophen-3-ylmethylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 171127509 |
| Molecular Formula | C8H6N2OS2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 209.99 |
| IUPAC Name | (5E)-2-imino-5-(thiophen-3-ylmethylidene)-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1/NC(=O)/C(=C\c2ccsc2)S1 |
| InChI | InChI=1S/C8H6N2OS2/c9-8-10-7(11)6(13-8)3-5-1-2-12-4-5/h1-4H,(H2,9,10,11)/b6-3+ |
| InChIKey | LMIMBTHCPZTIRH-ZZXKWVIFSA-N |
| XLogP | 1.89 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|