C12H12N2O2S — CID 171127950
5-[(2-ethoxyphenyl)methylidene]-2-imino-1,3-thiazolidin-4-one (PubChem CID 171127950) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is 5-[(2-ethoxyphenyl)methylidene]-2-imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[(2-ethoxyphenyl)methylidene]-2-imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 171127950 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 5-[(2-ethoxyphenyl)methylidene]-2-imino-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\NC(=O)C(=Cc2ccccc2OCC)S1 |
| InChI | InChI=1S/C12H12N2O2S/c1-2-16-9-6-4-3-5-8(9)7-10-11(15)14-12(13)17-10/h3-7H,2H2,1H3,(H2,13,14,15) |
| InChIKey | UTFSGLHWEXAKJJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_D(8)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|