C21H16N2O2S — CID 171128786
2-imino-5-[[3-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 171128786) has the molecular formula C21H16N2O2S and a molecular weight of 360.44 g/mol. Its IUPAC name is 2-imino-5-[[3-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-imino-5-[[3-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 171128786 |
| Molecular Formula | C21H16N2O2S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 2-imino-5-[[3-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1/NC(=O)C(=Cc2cccc(OCc3cccc4ccccc34)c2)S1 |
| InChI | InChI=1S/C21H16N2O2S/c22-21-23-20(24)19(26-21)12-14-5-3-9-17(11-14)25-13-16-8-4-7-15-6-1-2-10-18(15)16/h1-12H,13H2,(H2,22,23,24) |
| InChIKey | RARXDCVMDHDSET-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|