C22H22N2O3 — CID 171129692
2-[3,5-dimethyl-2-(2-nitrophenoxy)phenyl]-4,6-dimethylaniline (PubChem CID 171129692) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is 2-[3,5-dimethyl-2-(2-nitrophenoxy)phenyl]-4,6-dimethylaniline.
| Compound Name | 2-[3,5-dimethyl-2-(2-nitrophenoxy)phenyl]-4,6-dimethylaniline |
|---|---|
| PubChem CID | 171129692 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 2-[3,5-dimethyl-2-(2-nitrophenoxy)phenyl]-4,6-dimethylaniline |
| SMILES | Cc1cc(C)c(N)c(-c2cc(C)cc(C)c2Oc2ccccc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H22N2O3/c1-13-9-15(3)21(23)17(11-13)18-12-14(2)10-16(4)22(18)27-20-8-6-5-7-19(20)24(25)26/h5-12H,23H2,1-4H3 |
| InChIKey | BPCTYAHAFVOZJQ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|