C12H11NO2 — CID 171129746
N-(11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraen-4-yl)acetamide (PubChem CID 171129746) has the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. Its IUPAC name is N-(11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraen-4-yl)acetamide.
| Compound Name | N-(11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraen-4-yl)acetamide |
|---|---|
| PubChem CID | 171129746 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | N-(11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraen-4-yl)acetamide |
| SMILES | CC(=O)Nc1ccc2c(c1)C1C=CC2O1 |
| InChI | InChI=1S/C12H11NO2/c1-7(14)13-8-2-3-9-10(6-8)12-5-4-11(9)15-12/h2-6,11-12H,1H3,(H,13,14) |
| InChIKey | IRPPEJOXBZEAMT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|