C13H20N2O2 — CID 171130228
4-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]morpholine (PubChem CID 171130228) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 4-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]morpholine.
| Compound Name | 4-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]morpholine |
|---|---|
| PubChem CID | 171130228 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 4-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]morpholine |
| SMILES | COc1c(C)cnc(CN2CCOCC2)c1C |
| InChI | InChI=1S/C13H20N2O2/c1-10-8-14-12(11(2)13(10)16-3)9-15-4-6-17-7-5-15/h8H,4-7,9H2,1-3H3 |
| InChIKey | TZNNNXWHXWTBQN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |