About N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-2-(4-methylpyrazol-1-yl)acetamide
N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-2-(4-methylpyrazol-1-yl)acetamide (PubChem CID 171130879) has the molecular formula C12H15FN6O
and a molecular weight of 278.29 g/mol. Its IUPAC name is N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-2-(4-methylpyrazol-1-yl)acetamide.
Molecular Properties
| Compound Name | N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-2-(4-methylpyrazol-1-yl)acetamide |
| PubChem CID | 171130879 |
| Molecular Formula | C12H15FN6O |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-2-(4-methylpyrazol-1-yl)acetamide |
| SMILES | Cc1cnn(CC(=O)NN=Cc2c(C)nn(C)c2F)c1 |
| InChI | InChI=1S/C12H15FN6O/c1-8-4-15-19(6-8)7-11(20)16-14-5-10-9(2)17-18(3)12(10)13/h4-6H,7H2,1-3H3,(H,16,20) |
| InChIKey | GQFMLTJNMATXMZ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-2-(4-methylpyrazol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-2-(4-methylpyrazol-1-yl)acetamide?
The IUPAC name of N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-2-(4-methylpyrazol-1-yl)acetamide (CID 171130879) is N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-2-(4-methylpyrazol-1-yl)acetamide.
What is the SMILES notation for N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-2-(4-methylpyrazol-1-yl)acetamide?
The canonical SMILES for N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-2-(4-methylpyrazol-1-yl)acetamide is Cc1cnn(CC(=O)NN=Cc2c(C)nn(C)c2F)c1.
What is the InChIKey of N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-2-(4-methylpyrazol-1-yl)acetamide?
The InChIKey is GQFMLTJNMATXMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15FN6O/c1-8-4-15-19(6-8)7-11(20)16-14-5-10-9(2)17-18(3)12(10)13/h4-6H,7H2,1-3H3,(H,16,20).
What are the key properties of N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-2-(4-methylpyrazol-1-yl)acetamide?
N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-2-(4-methylpyrazol-1-yl)acetamide has a molecular weight of 278.29 g/mol, XLogP of 0.52, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-2-(4-methylpyrazol-1-yl)acetamide is sourced from PubChem (CID 171130879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).