C12H11ClF4N6O — CID 171131005
4-chloro-N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 171131005) has the molecular formula C12H11ClF4N6O and a molecular weight of 366.71 g/mol. Its IUPAC name is 4-chloro-N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | 4-chloro-N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 171131005 |
| Molecular Formula | C12H11ClF4N6O |
| Molecular Weight | 366.71 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 4-chloro-N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | Cc1nn(C)c(F)c1C=NNC(=O)c1c(Cl)c(C(F)(F)F)nn1C |
| InChI | InChI=1S/C12H11ClF4N6O/c1-5-6(10(14)23(3)20-5)4-18-19-11(24)8-7(13)9(12(15,16)17)21-22(8)2/h4H,1-3H3,(H,19,24) |
| InChIKey | UWJAJEBRMBZMAX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.71 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|