C15H12F6N8 — CID 171131251
4-(1-methylpyrazol-4-yl)-N-[[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 171131251) has the molecular formula C15H12F6N8 and a molecular weight of 418.31 g/mol. Its IUPAC name is 4-(1-methylpyrazol-4-yl)-N-[[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]-6-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | 4-(1-methylpyrazol-4-yl)-N-[[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]-6-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 171131251 |
| Molecular Formula | C15H12F6N8 |
| Molecular Weight | 418.31 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 4-(1-methylpyrazol-4-yl)-N-[[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | Cn1cc(-c2cc(C(F)(F)F)nc(NN=Cc3ccn(CC(F)(F)F)n3)n2)cn1 |
| InChI | InChI=1S/C15H12F6N8/c1-28-7-9(5-23-28)11-4-12(15(19,20)21)25-13(24-11)26-22-6-10-2-3-29(27-10)8-14(16,17)18/h2-7H,8H2,1H3,(H,24,25,26) |
| InChIKey | NFWBVNJPDMKVKQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|