C13H13FN8O2 — CID 171131269
N-[(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-2-(4-oxopyrazolo[1,5-d][1,2,4]triazin-5-yl)acetamide (PubChem CID 171131269) has the molecular formula C13H13FN8O2 and a molecular weight of 332.30 g/mol. Its IUPAC name is N-[(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-2-(4-oxopyrazolo[1,5-d][1,2,4]triazin-5-yl)acetamide.
| Compound Name | N-[(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-2-(4-oxopyrazolo[1,5-d][1,2,4]triazin-5-yl)acetamide |
|---|---|
| PubChem CID | 171131269 |
| Molecular Formula | C13H13FN8O2 |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | N-[(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-2-(4-oxopyrazolo[1,5-d][1,2,4]triazin-5-yl)acetamide |
| SMILES | CCn1ncc(C=NNC(=O)Cn2ncn3nccc3c2=O)c1F |
| InChI | InChI=1S/C13H13FN8O2/c1-2-20-12(14)9(6-17-20)5-15-19-11(23)7-21-13(24)10-3-4-16-22(10)8-18-21/h3-6,8H,2,7H2,1H3,(H,19,23) |
| InChIKey | JEYITJGQSNTPHE-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 111.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|