C14H17N5O3S — CID 171131271
3-[(2-hydroxy-3-methoxyphenyl)methylideneamino]-4,6-dimethyl-2-sulfanylidene-3a,6a-dihydro-1H-imidazo[4,5-d]imidazol-5-one (PubChem CID 171131271) has the molecular formula C14H17N5O3S and a molecular weight of 335.39 g/mol. Its IUPAC name is 3-[(2-hydroxy-3-methoxyphenyl)methylideneamino]-4,6-dimethyl-2-sulfanylidene-3a,6a-dihydro-1H-imidazo[4,5-d]imidazol-5-one.
| Compound Name | 3-[(2-hydroxy-3-methoxyphenyl)methylideneamino]-4,6-dimethyl-2-sulfanylidene-3a,6a-dihydro-1H-imidazo[4,5-d]imidazol-5-one |
|---|---|
| PubChem CID | 171131271 |
| Molecular Formula | C14H17N5O3S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 3-[(2-hydroxy-3-methoxyphenyl)methylideneamino]-4,6-dimethyl-2-sulfanylidene-3a,6a-dihydro-1H-imidazo[4,5-d]imidazol-5-one |
| SMILES | COc1cccc(C=NN2C(=S)NC3C2N(C)C(=O)N3C)c1O |
| InChI | InChI=1S/C14H17N5O3S/c1-17-11-12(18(2)14(17)21)19(13(23)16-11)15-7-8-5-4-6-9(22-3)10(8)20/h4-7,11-12,20H,1-3H3,(H,16,23) |
| InChIKey | MHOFXQFWBAVWLA-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|