C20H23NO3 — CID 17113230
2-(3,4-dimethylphenoxy)-N-[2-(2-methylprop-2-enoxy)phenyl]acetamide (PubChem CID 17113230) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is 2-(3,4-dimethylphenoxy)-N-[2-(2-methylprop-2-enoxy)phenyl]acetamide.
| Compound Name | 2-(3,4-dimethylphenoxy)-N-[2-(2-methylprop-2-enoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 17113230 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 2-(3,4-dimethylphenoxy)-N-[2-(2-methylprop-2-enoxy)phenyl]acetamide |
| SMILES | C=C(C)COc1ccccc1NC(=O)COc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C20H23NO3/c1-14(2)12-24-19-8-6-5-7-18(19)21-20(22)13-23-17-10-9-15(3)16(4)11-17/h5-11H,1,12-13H2,2-4H3,(H,21,22) |
| InChIKey | RUGPLAKZEDQJQE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|