C20H16N6OS — CID 171132486
6-[2-(4-methoxyphenyl)ethenyl]-3-(2-methylimidazo[1,2-a]pyridin-3-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 171132486) has the molecular formula C20H16N6OS and a molecular weight of 388.46 g/mol. Its IUPAC name is 6-[2-(4-methoxyphenyl)ethenyl]-3-(2-methylimidazo[1,2-a]pyridin-3-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-[2-(4-methoxyphenyl)ethenyl]-3-(2-methylimidazo[1,2-a]pyridin-3-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 171132486 |
| Molecular Formula | C20H16N6OS |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 6-[2-(4-methoxyphenyl)ethenyl]-3-(2-methylimidazo[1,2-a]pyridin-3-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | COc1ccc(C=Cc2nn3c(-c4c(C)nc5ccccn45)nnc3s2)cc1 |
| InChI | InChI=1S/C20H16N6OS/c1-13-18(25-12-4-3-5-16(25)21-13)19-22-23-20-26(19)24-17(28-20)11-8-14-6-9-15(27-2)10-7-14/h3-12H,1-2H3 |
| InChIKey | ZGAQKBLKCPZLFD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 69.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |