C29H30N4O4S — CID 171133183
6-amino-N-[2,5-dimethoxy-4-(phenylcarbamoyl)phenyl]-4-thia-2-azatricyclo[7.6.0.03,7]pentadeca-1,3(7),5,8-tetraene-5-carboxamide (PubChem CID 171133183) has the molecular formula C29H30N4O4S and a molecular weight of 530.65 g/mol. Its IUPAC name is 6-amino-N-[2,5-dimethoxy-4-(phenylcarbamoyl)phenyl]-4-thia-2-azatricyclo[7.6.0.03,7]pentadeca-1,3(7),5,8-tetraene-5-carboxamide.
| Compound Name | 6-amino-N-[2,5-dimethoxy-4-(phenylcarbamoyl)phenyl]-4-thia-2-azatricyclo[7.6.0.03,7]pentadeca-1,3(7),5,8-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 171133183 |
| Molecular Formula | C29H30N4O4S |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | 6-amino-N-[2,5-dimethoxy-4-(phenylcarbamoyl)phenyl]-4-thia-2-azatricyclo[7.6.0.03,7]pentadeca-1,3(7),5,8-tetraene-5-carboxamide |
| SMILES | COc1cc(C(=O)Nc2ccccc2)c(OC)cc1NC(=O)c1sc2nc3c(cc2c1N)CCCCCC3 |
| InChI | InChI=1S/C29H30N4O4S/c1-36-23-16-22(24(37-2)15-19(23)27(34)31-18-11-7-5-8-12-18)32-28(35)26-25(30)20-14-17-10-6-3-4-9-13-21(17)33-29(20)38-26/h5,7-8,11-12,14-16H,3-4,6,9-10,13,30H2,1-2H3,(H,31,34)(H,32,35) |
| InChIKey | RZWHGFQCIYHBFQ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |