C26H26N4O4S — CID 171133235
[3-amino-6-methyl-4-(3,4,5-trimethoxyphenyl)-7,8-dihydro-5H-thieno[2,3-b][1,6]naphthyridin-2-yl]-pyridin-4-ylmethanone (PubChem CID 171133235) has the molecular formula C26H26N4O4S and a molecular weight of 490.59 g/mol. Its IUPAC name is [3-amino-6-methyl-4-(3,4,5-trimethoxyphenyl)-7,8-dihydro-5H-thieno[2,3-b][1,6]naphthyridin-2-yl]-pyridin-4-ylmethanone.
| Compound Name | [3-amino-6-methyl-4-(3,4,5-trimethoxyphenyl)-7,8-dihydro-5H-thieno[2,3-b][1,6]naphthyridin-2-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 171133235 |
| Molecular Formula | C26H26N4O4S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | [3-amino-6-methyl-4-(3,4,5-trimethoxyphenyl)-7,8-dihydro-5H-thieno[2,3-b][1,6]naphthyridin-2-yl]-pyridin-4-ylmethanone |
| SMILES | COc1cc(-c2c3c(nc4sc(C(=O)c5ccncc5)c(N)c24)CCN(C)C3)cc(OC)c1OC |
| InChI | InChI=1S/C26H26N4O4S/c1-30-10-7-17-16(13-30)20(15-11-18(32-2)24(34-4)19(12-15)33-3)21-22(27)25(35-26(21)29-17)23(31)14-5-8-28-9-6-14/h5-6,8-9,11-12H,7,10,13,27H2,1-4H3 |
| InChIKey | PAVDLJCQFZZKOP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 99.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |