C12H18ClNO3 — CID 171134030
5-[(2-methylpiperidin-1-yl)methyl]furan-2-carboxylic acid;hydrochloride (PubChem CID 171134030) has the molecular formula C12H18ClNO3 and a molecular weight of 259.73 g/mol. Its IUPAC name is 5-[(2-methylpiperidin-1-yl)methyl]furan-2-carboxylic acid;hydrochloride.
| Compound Name | 5-[(2-methylpiperidin-1-yl)methyl]furan-2-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 171134030 |
| Molecular Formula | C12H18ClNO3 |
| Molecular Weight | 259.73 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 5-[(2-methylpiperidin-1-yl)methyl]furan-2-carboxylic acid;hydrochloride |
| SMILES | CC1CCCCN1Cc1ccc(C(=O)O)o1.Cl |
| InChI | InChI=1S/C12H17NO3.ClH/c1-9-4-2-3-7-13(9)8-10-5-6-11(16-10)12(14)15;/h5-6,9H,2-4,7-8H2,1H3,(H,14,15);1H |
| InChIKey | DATFFPRJABFLRY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.73 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |