C24H26FN3O2 — CID 171134516
6-[3-(3-fluorophenyl)prop-2-enoyl]-N-(2-pyridin-2-ylethyl)-6-azaspiro[2.5]octane-2-carboxamide (PubChem CID 171134516) has the molecular formula C24H26FN3O2 and a molecular weight of 407.49 g/mol. Its IUPAC name is 6-[3-(3-fluorophenyl)prop-2-enoyl]-N-(2-pyridin-2-ylethyl)-6-azaspiro[2.5]octane-2-carboxamide.
| Compound Name | 6-[3-(3-fluorophenyl)prop-2-enoyl]-N-(2-pyridin-2-ylethyl)-6-azaspiro[2.5]octane-2-carboxamide |
|---|---|
| PubChem CID | 171134516 |
| Molecular Formula | C24H26FN3O2 |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 6-[3-(3-fluorophenyl)prop-2-enoyl]-N-(2-pyridin-2-ylethyl)-6-azaspiro[2.5]octane-2-carboxamide |
| SMILES | O=C(NCCc1ccccn1)C1CC12CCN(C(=O)C=Cc1cccc(F)c1)CC2 |
| InChI | InChI=1S/C24H26FN3O2/c25-19-5-3-4-18(16-19)7-8-22(29)28-14-10-24(11-15-28)17-21(24)23(30)27-13-9-20-6-1-2-12-26-20/h1-8,12,16,21H,9-11,13-15,17H2,(H,27,30) |
| InChIKey | QTDBJGYPGDEENN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|