C16H22N6 — CID 171134725
N-[[5-(2-methylbut-2-enyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methyl]pyrazin-2-amine (PubChem CID 171134725) has the molecular formula C16H22N6 and a molecular weight of 298.39 g/mol. Its IUPAC name is N-[[5-(2-methylbut-2-enyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methyl]pyrazin-2-amine.
| Compound Name | N-[[5-(2-methylbut-2-enyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 171134725 |
| Molecular Formula | C16H22N6 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | N-[[5-(2-methylbut-2-enyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methyl]pyrazin-2-amine |
| SMILES | CC=C(C)CN1CCn2nc(CNc3cnccn3)cc2C1 |
| InChI | InChI=1S/C16H22N6/c1-3-13(2)11-21-6-7-22-15(12-21)8-14(20-22)9-19-16-10-17-4-5-18-16/h3-5,8,10H,6-7,9,11-12H2,1-2H3,(H,18,19) |
| InChIKey | SKHHHYGZSILDRS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|