C19H29N3O2 — CID 171134955
6-tert-butyl-N-(3,7-dimethylocta-2,6-dienyl)-2-oxo-1H-pyrimidine-4-carboxamide (PubChem CID 171134955) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 6-tert-butyl-N-(3,7-dimethylocta-2,6-dienyl)-2-oxo-1H-pyrimidine-4-carboxamide.
| Compound Name | 6-tert-butyl-N-(3,7-dimethylocta-2,6-dienyl)-2-oxo-1H-pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 171134955 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 6-tert-butyl-N-(3,7-dimethylocta-2,6-dienyl)-2-oxo-1H-pyrimidine-4-carboxamide |
| SMILES | CC(C)=CCCC(C)=CCNC(=O)c1cc(C(C)(C)C)[nH]c(=O)n1 |
| InChI | InChI=1S/C19H29N3O2/c1-13(2)8-7-9-14(3)10-11-20-17(23)15-12-16(19(4,5)6)22-18(24)21-15/h8,10,12H,7,9,11H2,1-6H3,(H,20,23)(H,21,22,24) |
| InChIKey | KRYQQWRRPOFSCK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|