C22H23NO7S — CID 171135553
(9bR)-6-acetyl-7,9-dihydroxy-2-[1-[(4-hydroxythiolan-3-yl)amino]ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione (PubChem CID 171135553) has the molecular formula C22H23NO7S and a molecular weight of 445.49 g/mol. Its IUPAC name is (9bR)-6-acetyl-7,9-dihydroxy-2-[1-[(4-hydroxythiolan-3-yl)amino]ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione.
| Compound Name | (9bR)-6-acetyl-7,9-dihydroxy-2-[1-[(4-hydroxythiolan-3-yl)amino]ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione |
|---|---|
| PubChem CID | 171135553 |
| Molecular Formula | C22H23NO7S |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | (9bR)-6-acetyl-7,9-dihydroxy-2-[1-[(4-hydroxythiolan-3-yl)amino]ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)C(=C(C)NC3CSCC3O)C(=O)[C@@]12C |
| InChI | InChI=1S/C22H23NO7S/c1-8-18(27)16(10(3)24)20-17(19(8)28)22(4)14(30-20)5-12(25)15(21(22)29)9(2)23-11-6-31-7-13(11)26/h5,11,13,23,26-28H,6-7H2,1-4H3/t11?,13?,22-/m0/s1 |
| InChIKey | ZLCUAISAQVPXBL-JJOMBDOASA-N |
| XLogP | 1.63 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|