C19H14ClNO4S — CID 171136069
methyl 2-(3-chlorophenyl)imino-4-hydroxy-5-[(2-hydroxyphenyl)methylidene]thiophene-3-carboxylate (PubChem CID 171136069) has the molecular formula C19H14ClNO4S and a molecular weight of 387.84 g/mol. Its IUPAC name is methyl 2-(3-chlorophenyl)imino-4-hydroxy-5-[(2-hydroxyphenyl)methylidene]thiophene-3-carboxylate.
| Compound Name | methyl 2-(3-chlorophenyl)imino-4-hydroxy-5-[(2-hydroxyphenyl)methylidene]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 171136069 |
| Molecular Formula | C19H14ClNO4S |
| Molecular Weight | 387.84 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | methyl 2-(3-chlorophenyl)imino-4-hydroxy-5-[(2-hydroxyphenyl)methylidene]thiophene-3-carboxylate |
| SMILES | COC(=O)C1=C(O)C(=Cc2ccccc2O)S/C1=N\c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H14ClNO4S/c1-25-19(24)16-17(23)15(9-11-5-2-3-8-14(11)22)26-18(16)21-13-7-4-6-12(20)10-13/h2-10,22-23H,1H3/b15-9?,21-18- |
| InChIKey | SUJJBZGSHGUHBV-HAAOTLMFSA-N |
| XLogP | 4.85 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.84 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|