C20H30N2 — CID 171138074
3-[1-(3,7-dimethylocta-2,6-dienyl)piperidin-2-yl]pyridine (PubChem CID 171138074) has the molecular formula C20H30N2 and a molecular weight of 298.47 g/mol. Its IUPAC name is 3-[1-(3,7-dimethylocta-2,6-dienyl)piperidin-2-yl]pyridine.
| Compound Name | 3-[1-(3,7-dimethylocta-2,6-dienyl)piperidin-2-yl]pyridine |
|---|---|
| PubChem CID | 171138074 |
| Molecular Formula | C20H30N2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | 3-[1-(3,7-dimethylocta-2,6-dienyl)piperidin-2-yl]pyridine |
| SMILES | CC(C)=CCCC(C)=CCN1CCCCC1c1cccnc1 |
| InChI | InChI=1S/C20H30N2/c1-17(2)8-6-9-18(3)12-15-22-14-5-4-11-20(22)19-10-7-13-21-16-19/h7-8,10,12-13,16,20H,4-6,9,11,14-15H2,1-3H3 |
| InChIKey | LTAMQJCRHPXNLE-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|