C22H28N2O2S — CID 171139695
1-[2-[4-[(dimethylamino)methyl]phenyl]piperidin-1-yl]-3-[4-(hydroxymethyl)thiophen-2-yl]prop-2-en-1-one (PubChem CID 171139695) has the molecular formula C22H28N2O2S and a molecular weight of 384.55 g/mol. Its IUPAC name is 1-[2-[4-[(dimethylamino)methyl]phenyl]piperidin-1-yl]-3-[4-(hydroxymethyl)thiophen-2-yl]prop-2-en-1-one.
| Compound Name | 1-[2-[4-[(dimethylamino)methyl]phenyl]piperidin-1-yl]-3-[4-(hydroxymethyl)thiophen-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 171139695 |
| Molecular Formula | C22H28N2O2S |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 1-[2-[4-[(dimethylamino)methyl]phenyl]piperidin-1-yl]-3-[4-(hydroxymethyl)thiophen-2-yl]prop-2-en-1-one |
| SMILES | CN(C)Cc1ccc(C2CCCCN2C(=O)C=Cc2cc(CO)cs2)cc1 |
| InChI | InChI=1S/C22H28N2O2S/c1-23(2)14-17-6-8-19(9-7-17)21-5-3-4-12-24(21)22(26)11-10-20-13-18(15-25)16-27-20/h6-11,13,16,21,25H,3-5,12,14-15H2,1-2H3 |
| InChIKey | CLGMAUWYAYCRKG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|