C18H27N5O2 — CID 171139889
3-[2-(dimethylamino)pyrimidin-5-yl]-N-(2-oxa-8-azaspiro[4.5]decan-3-ylmethyl)prop-2-enamide (PubChem CID 171139889) has the molecular formula C18H27N5O2 and a molecular weight of 345.45 g/mol. Its IUPAC name is 3-[2-(dimethylamino)pyrimidin-5-yl]-N-(2-oxa-8-azaspiro[4.5]decan-3-ylmethyl)prop-2-enamide.
| Compound Name | 3-[2-(dimethylamino)pyrimidin-5-yl]-N-(2-oxa-8-azaspiro[4.5]decan-3-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 171139889 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 3-[2-(dimethylamino)pyrimidin-5-yl]-N-(2-oxa-8-azaspiro[4.5]decan-3-ylmethyl)prop-2-enamide |
| SMILES | CN(C)c1ncc(C=CC(=O)NCC2CC3(CCNCC3)CO2)cn1 |
| InChI | InChI=1S/C18H27N5O2/c1-23(2)17-21-10-14(11-22-17)3-4-16(24)20-12-15-9-18(13-25-15)5-7-19-8-6-18/h3-4,10-11,15,19H,5-9,12-13H2,1-2H3,(H,20,24) |
| InChIKey | GARDZONTSKTYKA-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|