C10H12FNO3 — CID 171140042
1-(2-fluoro-2-methylpropyl)-6-oxopyridine-3-carboxylic acid (PubChem CID 171140042) has the molecular formula C10H12FNO3 and a molecular weight of 213.21 g/mol. Its IUPAC name is 1-(2-fluoro-2-methylpropyl)-6-oxopyridine-3-carboxylic acid.
| Compound Name | 1-(2-fluoro-2-methylpropyl)-6-oxopyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 171140042 |
| Molecular Formula | C10H12FNO3 |
| Molecular Weight | 213.21 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 1-(2-fluoro-2-methylpropyl)-6-oxopyridine-3-carboxylic acid |
| SMILES | CC(C)(F)Cn1cc(C(=O)O)ccc1=O |
| InChI | InChI=1S/C10H12FNO3/c1-10(2,11)6-12-5-7(9(14)15)3-4-8(12)13/h3-5H,6H2,1-2H3,(H,14,15) |
| InChIKey | OIVJXAIZBFJPKM-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.21 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |