C17H16N4OS — CID 171140268
N-[(1-methyl-3-pyridin-2-ylpyrazol-5-yl)methyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 171140268) has the molecular formula C17H16N4OS and a molecular weight of 324.41 g/mol. Its IUPAC name is N-[(1-methyl-3-pyridin-2-ylpyrazol-5-yl)methyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-[(1-methyl-3-pyridin-2-ylpyrazol-5-yl)methyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 171140268 |
| Molecular Formula | C17H16N4OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | N-[(1-methyl-3-pyridin-2-ylpyrazol-5-yl)methyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | Cn1nc(-c2ccccn2)cc1CNC(=O)C=Cc1cccs1 |
| InChI | InChI=1S/C17H16N4OS/c1-21-13(11-16(20-21)15-6-2-3-9-18-15)12-19-17(22)8-7-14-5-4-10-23-14/h2-11H,12H2,1H3,(H,19,22) |
| InChIKey | YFYMNIIGDRAXAH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|