C20H25N5O3S — CID 171140808
3-(1-methylpiperidin-3-yl)-6-[2-(3,4,5-trimethoxyphenyl)ethenyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 171140808) has the molecular formula C20H25N5O3S and a molecular weight of 415.52 g/mol. Its IUPAC name is 3-(1-methylpiperidin-3-yl)-6-[2-(3,4,5-trimethoxyphenyl)ethenyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 3-(1-methylpiperidin-3-yl)-6-[2-(3,4,5-trimethoxyphenyl)ethenyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 171140808 |
| Molecular Formula | C20H25N5O3S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 3-(1-methylpiperidin-3-yl)-6-[2-(3,4,5-trimethoxyphenyl)ethenyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | COc1cc(C=Cc2nn3c(C4CCCN(C)C4)nnc3s2)cc(OC)c1OC |
| InChI | InChI=1S/C20H25N5O3S/c1-24-9-5-6-14(12-24)19-21-22-20-25(19)23-17(29-20)8-7-13-10-15(26-2)18(28-4)16(11-13)27-3/h7-8,10-11,14H,5-6,9,12H2,1-4H3 |
| InChIKey | YEPLRUAROODKJH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 74.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |