About 5-(cinnamylideneamino)-1,3-dimethylbenzimidazol-2-one
5-(cinnamylideneamino)-1,3-dimethylbenzimidazol-2-one (PubChem CID 171140821) has the molecular formula C18H17N3O
and a molecular weight of 291.35 g/mol. Its IUPAC name is 5-(cinnamylideneamino)-1,3-dimethylbenzimidazol-2-one.
Molecular Properties
| Compound Name | 5-(cinnamylideneamino)-1,3-dimethylbenzimidazol-2-one |
| PubChem CID | 171140821 |
| Molecular Formula | C18H17N3O |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 5-(cinnamylideneamino)-1,3-dimethylbenzimidazol-2-one |
| SMILES | Cn1c(=O)n(C)c2cc(/N=C/C=Cc3ccccc3)ccc21 |
| InChI | InChI=1S/C18H17N3O/c1-20-16-11-10-15(13-17(16)21(2)18(20)22)19-12-6-9-14-7-4-3-5-8-14/h3-13H,1-2H3/b9-6?,19-12+ |
| InChIKey | CZJOAOZCYJSEEF-VEBJQGQQSA-N |
| XLogP | 3.29 |
| TPSA | 39.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-(cinnamylideneamino)-1,3-dimethylbenzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(cinnamylideneamino)-1,3-dimethylbenzimidazol-2-one?
The IUPAC name of 5-(cinnamylideneamino)-1,3-dimethylbenzimidazol-2-one (CID 171140821) is 5-(cinnamylideneamino)-1,3-dimethylbenzimidazol-2-one.
What is the SMILES notation for 5-(cinnamylideneamino)-1,3-dimethylbenzimidazol-2-one?
The canonical SMILES for 5-(cinnamylideneamino)-1,3-dimethylbenzimidazol-2-one is Cn1c(=O)n(C)c2cc(/N=C/C=Cc3ccccc3)ccc21.
What is the InChIKey of 5-(cinnamylideneamino)-1,3-dimethylbenzimidazol-2-one?
The InChIKey is CZJOAOZCYJSEEF-VEBJQGQQSA-N. The full InChI is InChI=1S/C18H17N3O/c1-20-16-11-10-15(13-17(16)21(2)18(20)22)19-12-6-9-14-7-4-3-5-8-14/h3-13H,1-2H3/b9-6?,19-12+.
What are the key properties of 5-(cinnamylideneamino)-1,3-dimethylbenzimidazol-2-one?
5-(cinnamylideneamino)-1,3-dimethylbenzimidazol-2-one has a molecular weight of 291.35 g/mol, XLogP of 3.29, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(cinnamylideneamino)-1,3-dimethylbenzimidazol-2-one is sourced from PubChem (CID 171140821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).