C25H28N2O5 — CID 171142406
3-methoxy-4-[1-(4-methoxybenzoyl)-3,6-dihydro-2H-pyridin-4-yl]-1-[(4-methoxyphenyl)methyl]azetidin-2-one (PubChem CID 171142406) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is 3-methoxy-4-[1-(4-methoxybenzoyl)-3,6-dihydro-2H-pyridin-4-yl]-1-[(4-methoxyphenyl)methyl]azetidin-2-one.
| Compound Name | 3-methoxy-4-[1-(4-methoxybenzoyl)-3,6-dihydro-2H-pyridin-4-yl]-1-[(4-methoxyphenyl)methyl]azetidin-2-one |
|---|---|
| PubChem CID | 171142406 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 3-methoxy-4-[1-(4-methoxybenzoyl)-3,6-dihydro-2H-pyridin-4-yl]-1-[(4-methoxyphenyl)methyl]azetidin-2-one |
| SMILES | COc1ccc(CN2C(=O)C(OC)C2C2=CCN(C(=O)c3ccc(OC)cc3)CC2)cc1 |
| InChI | InChI=1S/C25H28N2O5/c1-30-20-8-4-17(5-9-20)16-27-22(23(32-3)25(27)29)18-12-14-26(15-13-18)24(28)19-6-10-21(31-2)11-7-19/h4-12,22-23H,13-16H2,1-3H3 |
| InChIKey | WNHVDBDJLZWVEY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|