C17H26N2O4 — CID 171142799
1-[3a-(hydroxymethyl)-5-[(5-methylfuran-2-yl)methyl]-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-2-yl]-2-methoxyethanone (PubChem CID 171142799) has the molecular formula C17H26N2O4 and a molecular weight of 322.40 g/mol. Its IUPAC name is 1-[3a-(hydroxymethyl)-5-[(5-methylfuran-2-yl)methyl]-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-2-yl]-2-methoxyethanone.
| Compound Name | 1-[3a-(hydroxymethyl)-5-[(5-methylfuran-2-yl)methyl]-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-2-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 171142799 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 1-[3a-(hydroxymethyl)-5-[(5-methylfuran-2-yl)methyl]-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-2-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CC2CCN(Cc3ccc(C)o3)CC2(CO)C1 |
| InChI | InChI=1S/C17H26N2O4/c1-13-3-4-15(23-13)8-18-6-5-14-7-19(16(21)9-22-2)11-17(14,10-18)12-20/h3-4,14,20H,5-12H2,1-2H3 |
| InChIKey | RYIYWAWTIYYMSH-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |