C15H20FN3O4S — CID 171142806
[3a-(hydroxymethyl)-2-methylsulfonyl-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-5-yl]-(5-fluoro-2-pyridinyl)methanone (PubChem CID 171142806) has the molecular formula C15H20FN3O4S and a molecular weight of 357.41 g/mol. Its IUPAC name is [3a-(hydroxymethyl)-2-methylsulfonyl-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-5-yl]-(5-fluoro-2-pyridinyl)methanone.
| Compound Name | [3a-(hydroxymethyl)-2-methylsulfonyl-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-5-yl]-(5-fluoro-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 171142806 |
| Molecular Formula | C15H20FN3O4S |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | [3a-(hydroxymethyl)-2-methylsulfonyl-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-5-yl]-(5-fluoro-2-pyridinyl)methanone |
| SMILES | CS(=O)(=O)N1CC2CCN(C(=O)c3ccc(F)cn3)CC2(CO)C1 |
| InChI | InChI=1S/C15H20FN3O4S/c1-24(22,23)19-7-11-4-5-18(8-15(11,9-19)10-20)14(21)13-3-2-12(16)6-17-13/h2-3,6,11,20H,4-5,7-10H2,1H3 |
| InChIKey | BYIQDGDNTRILBQ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |