C22H22N4O4 — CID 171143498
[5-(2-methylfuran-3-carbonyl)-3a-(3-methyl-1,2,4-oxadiazol-5-yl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-2-yl]-phenylmethanone (PubChem CID 171143498) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is [5-(2-methylfuran-3-carbonyl)-3a-(3-methyl-1,2,4-oxadiazol-5-yl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-2-yl]-phenylmethanone.
| Compound Name | [5-(2-methylfuran-3-carbonyl)-3a-(3-methyl-1,2,4-oxadiazol-5-yl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 171143498 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | [5-(2-methylfuran-3-carbonyl)-3a-(3-methyl-1,2,4-oxadiazol-5-yl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-2-yl]-phenylmethanone |
| SMILES | Cc1noc(C23CN(C(=O)c4ccccc4)CC2CN(C(=O)c2ccoc2C)C3)n1 |
| InChI | InChI=1S/C22H22N4O4/c1-14-18(8-9-29-14)20(28)26-11-17-10-25(19(27)16-6-4-3-5-7-16)12-22(17,13-26)21-23-15(2)24-30-21/h3-9,17H,10-13H2,1-2H3 |
| InChIKey | UBJRKJGWNUPGQI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 92.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |