C19H28N2O4S — CID 171143637
[7a-(methoxymethyl)-2-methylsulfonyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-(2,4-dimethylphenyl)methanone (PubChem CID 171143637) has the molecular formula C19H28N2O4S and a molecular weight of 380.51 g/mol. Its IUPAC name is [7a-(methoxymethyl)-2-methylsulfonyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-(2,4-dimethylphenyl)methanone.
| Compound Name | [7a-(methoxymethyl)-2-methylsulfonyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-(2,4-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 171143637 |
| Molecular Formula | C19H28N2O4S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | [7a-(methoxymethyl)-2-methylsulfonyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-(2,4-dimethylphenyl)methanone |
| SMILES | COCC12CCN(C(=O)c3ccc(C)cc3C)CC1CN(S(C)(=O)=O)C2 |
| InChI | InChI=1S/C19H28N2O4S/c1-14-5-6-17(15(2)9-14)18(22)20-8-7-19(13-25-3)12-21(26(4,23)24)11-16(19)10-20/h5-6,9,16H,7-8,10-13H2,1-4H3 |
| InChIKey | JVMBXYXFRMCLSF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |