C18H27N3O3 — CID 171144918
2-[1-(3-methoxypropyl)-2,5-dimethylpyrrole-3-carbonyl]-3,3a,4,5,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-6-one (PubChem CID 171144918) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is 2-[1-(3-methoxypropyl)-2,5-dimethylpyrrole-3-carbonyl]-3,3a,4,5,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-6-one.
| Compound Name | 2-[1-(3-methoxypropyl)-2,5-dimethylpyrrole-3-carbonyl]-3,3a,4,5,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-6-one |
|---|---|
| PubChem CID | 171144918 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 2-[1-(3-methoxypropyl)-2,5-dimethylpyrrole-3-carbonyl]-3,3a,4,5,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-6-one |
| SMILES | COCCCn1c(C)cc(C(=O)N2CC3CNC(=O)CC3C2)c1C |
| InChI | InChI=1S/C18H27N3O3/c1-12-7-16(13(2)21(12)5-4-6-24-3)18(23)20-10-14-8-17(22)19-9-15(14)11-20/h7,14-15H,4-6,8-11H2,1-3H3,(H,19,22) |
| InChIKey | BRYTUUUTSDNHBY-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|