C11H12NO2- — CID 171145293
2-(3-cyclobutyl-2-pyridinyl)acetate (PubChem CID 171145293) has the molecular formula C11H12NO2- and a molecular weight of 190.22 g/mol. Its IUPAC name is 2-(3-cyclobutyl-2-pyridinyl)acetate.
| Compound Name | 2-(3-cyclobutyl-2-pyridinyl)acetate |
|---|---|
| PubChem CID | 171145293 |
| Molecular Formula | C11H12NO2- |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 2-(3-cyclobutyl-2-pyridinyl)acetate |
| SMILES | O=C([O-])Cc1ncccc1C1CCC1 |
| InChI | InChI=1S/C11H13NO2/c13-11(14)7-10-9(5-2-6-12-10)8-3-1-4-8/h2,5-6,8H,1,3-4,7H2,(H,13,14)/p-1 |
| InChIKey | KVGFRSJVNNNHBK-UHFFFAOYSA-M |
| XLogP | 0.64 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |