C28H36N2O4 — CID 171146666
2-[[(10R,13S,17S)-17-ethynyl-17-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]oxy-N-(furan-2-ylmethyl)acetamide (PubChem CID 171146666) has the molecular formula C28H36N2O4 and a molecular weight of 464.61 g/mol. Its IUPAC name is 2-[[(10R,13S,17S)-17-ethynyl-17-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]oxy-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[[(10R,13S,17S)-17-ethynyl-17-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]oxy-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 171146666 |
| Molecular Formula | C28H36N2O4 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | 2-[[(10R,13S,17S)-17-ethynyl-17-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]oxy-N-(furan-2-ylmethyl)acetamide |
| SMILES | C#C[C@@]1(O)CCC2C3CCC4=CC(=NOCC(=O)NCc5ccco5)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C28H36N2O4/c1-4-28(32)14-11-24-22-8-7-19-16-20(9-12-26(19,2)23(22)10-13-27(24,28)3)30-34-18-25(31)29-17-21-6-5-15-33-21/h1,5-6,15-16,22-24,32H,7-14,17-18H2,2-3H3,(H,29,31)/t22?,23?,24?,26-,27-,28+/m0/s1 |
| InChIKey | LENBTNUDRKQRAE-DZYFZBSVSA-N |
| XLogP | 4.60 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|