C23H27N3O3S — CID 171146894
(6R,11R)-5-methyl-10-(2-methyl-1,3-thiazole-4-carbonyl)-2-oxa-5,10-diazatricyclo[14.4.0.06,11]icosa-1(20),13,16,18-tetraen-4-one (PubChem CID 171146894) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is (6R,11R)-5-methyl-10-(2-methyl-1,3-thiazole-4-carbonyl)-2-oxa-5,10-diazatricyclo[14.4.0.06,11]icosa-1(20),13,16,18-tetraen-4-one.
| Compound Name | (6R,11R)-5-methyl-10-(2-methyl-1,3-thiazole-4-carbonyl)-2-oxa-5,10-diazatricyclo[14.4.0.06,11]icosa-1(20),13,16,18-tetraen-4-one |
|---|---|
| PubChem CID | 171146894 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | (6R,11R)-5-methyl-10-(2-methyl-1,3-thiazole-4-carbonyl)-2-oxa-5,10-diazatricyclo[14.4.0.06,11]icosa-1(20),13,16,18-tetraen-4-one |
| SMILES | Cc1nc(C(=O)N2CCC[C@@H]3[C@H]2CC=CCc2ccccc2OCC(=O)N3C)cs1 |
| InChI | InChI=1S/C23H27N3O3S/c1-16-24-18(15-30-16)23(28)26-13-7-11-19-20(26)10-5-3-8-17-9-4-6-12-21(17)29-14-22(27)25(19)2/h3-6,9,12,15,19-20H,7-8,10-11,13-14H2,1-2H3/t19-,20-/m1/s1 |
| InChIKey | ZNBSNVJDODLRIA-WOJBJXKFSA-N |
| XLogP | 3.46 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|