C23H27NO3 — CID 171147036
1-[3-[(3,4-dimethylphenoxy)methyl]-3-hydroxypiperidin-1-yl]-3-phenylprop-2-en-1-one (PubChem CID 171147036) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is 1-[3-[(3,4-dimethylphenoxy)methyl]-3-hydroxypiperidin-1-yl]-3-phenylprop-2-en-1-one.
| Compound Name | 1-[3-[(3,4-dimethylphenoxy)methyl]-3-hydroxypiperidin-1-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 171147036 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 1-[3-[(3,4-dimethylphenoxy)methyl]-3-hydroxypiperidin-1-yl]-3-phenylprop-2-en-1-one |
| SMILES | Cc1ccc(OCC2(O)CCCN(C(=O)C=Cc3ccccc3)C2)cc1C |
| InChI | InChI=1S/C23H27NO3/c1-18-9-11-21(15-19(18)2)27-17-23(26)13-6-14-24(16-23)22(25)12-10-20-7-4-3-5-8-20/h3-5,7-12,15,26H,6,13-14,16-17H2,1-2H3 |
| InChIKey | RVHUMJAYLVMPIV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|