C21H30N2O4 — CID 171147100
N-[(1R,2R,3R)-2-hydroxy-3-phenoxycycloheptyl]-4-morpholin-4-ylbut-2-enamide (PubChem CID 171147100) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is N-[(1R,2R,3R)-2-hydroxy-3-phenoxycycloheptyl]-4-morpholin-4-ylbut-2-enamide.
| Compound Name | N-[(1R,2R,3R)-2-hydroxy-3-phenoxycycloheptyl]-4-morpholin-4-ylbut-2-enamide |
|---|---|
| PubChem CID | 171147100 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | N-[(1R,2R,3R)-2-hydroxy-3-phenoxycycloheptyl]-4-morpholin-4-ylbut-2-enamide |
| SMILES | O=C(C=CCN1CCOCC1)N[C@@H]1CCCC[C@@H](Oc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C21H30N2O4/c24-20(11-6-12-23-13-15-26-16-14-23)22-18-9-4-5-10-19(21(18)25)27-17-7-2-1-3-8-17/h1-3,6-8,11,18-19,21,25H,4-5,9-10,12-16H2,(H,22,24)/t18-,19-,21-/m1/s1 |
| InChIKey | NUILNMWOACKFTD-SFHLNBCPSA-N |
| XLogP | 1.74 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|