C18H31N3O3 — CID 171147166
(5aS,9aR)-7-[4-(dimethylamino)but-2-enoyl]-1-(2-methoxyethyl)-3,4,5,5a,6,8,9,9a-octahydropyrido[4,3-b]azepin-2-one (PubChem CID 171147166) has the molecular formula C18H31N3O3 and a molecular weight of 337.46 g/mol. Its IUPAC name is (5aS,9aR)-7-[4-(dimethylamino)but-2-enoyl]-1-(2-methoxyethyl)-3,4,5,5a,6,8,9,9a-octahydropyrido[4,3-b]azepin-2-one.
| Compound Name | (5aS,9aR)-7-[4-(dimethylamino)but-2-enoyl]-1-(2-methoxyethyl)-3,4,5,5a,6,8,9,9a-octahydropyrido[4,3-b]azepin-2-one |
|---|---|
| PubChem CID | 171147166 |
| Molecular Formula | C18H31N3O3 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | (5aS,9aR)-7-[4-(dimethylamino)but-2-enoyl]-1-(2-methoxyethyl)-3,4,5,5a,6,8,9,9a-octahydropyrido[4,3-b]azepin-2-one |
| SMILES | COCCN1C(=O)CCC[C@H]2CN(C(=O)C=CCN(C)C)CC[C@H]21 |
| InChI | InChI=1S/C18H31N3O3/c1-19(2)10-5-8-17(22)20-11-9-16-15(14-20)6-4-7-18(23)21(16)12-13-24-3/h5,8,15-16H,4,6-7,9-14H2,1-3H3/t15-,16+/m0/s1 |
| InChIKey | NZQLPPVQJJAXHQ-JKSUJKDBSA-N |
| XLogP | 0.98 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|