C14H26N2O3 — CID 171147178
N-[(1R,2R,3R)-2,3-dihydroxycycloheptyl]-4-(dimethylamino)-N-methylbut-2-enamide (PubChem CID 171147178) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is N-[(1R,2R,3R)-2,3-dihydroxycycloheptyl]-4-(dimethylamino)-N-methylbut-2-enamide.
| Compound Name | N-[(1R,2R,3R)-2,3-dihydroxycycloheptyl]-4-(dimethylamino)-N-methylbut-2-enamide |
|---|---|
| PubChem CID | 171147178 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | N-[(1R,2R,3R)-2,3-dihydroxycycloheptyl]-4-(dimethylamino)-N-methylbut-2-enamide |
| SMILES | CN(C)CC=CC(=O)N(C)[C@@H]1CCCC[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H26N2O3/c1-15(2)10-6-9-13(18)16(3)11-7-4-5-8-12(17)14(11)19/h6,9,11-12,14,17,19H,4-5,7-8,10H2,1-3H3/t11-,12-,14-/m1/s1 |
| InChIKey | YUICYNSCTIOJJJ-YRGRVCCFSA-N |
| XLogP | 0.23 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|