C27H39N5O5 — CID 171147666
(1R,4S,12R)-1'-(2-methoxypyrimidine-5-carbonyl)-4-(2-methylpropyl)spiro[14-oxa-2,5-diazabicyclo[10.4.0]hexadec-9-ene-7,4'-piperidine]-3,6-dione (PubChem CID 171147666) has the molecular formula C27H39N5O5 and a molecular weight of 513.64 g/mol. Its IUPAC name is (1R,4S,12R)-1'-(2-methoxypyrimidine-5-carbonyl)-4-(2-methylpropyl)spiro[14-oxa-2,5-diazabicyclo[10.4.0]hexadec-9-ene-7,4'-piperidine]-3,6-dione.
| Compound Name | (1R,4S,12R)-1'-(2-methoxypyrimidine-5-carbonyl)-4-(2-methylpropyl)spiro[14-oxa-2,5-diazabicyclo[10.4.0]hexadec-9-ene-7,4'-piperidine]-3,6-dione |
|---|---|
| PubChem CID | 171147666 |
| Molecular Formula | C27H39N5O5 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | (1R,4S,12R)-1'-(2-methoxypyrimidine-5-carbonyl)-4-(2-methylpropyl)spiro[14-oxa-2,5-diazabicyclo[10.4.0]hexadec-9-ene-7,4'-piperidine]-3,6-dione |
| SMILES | COc1ncc(C(=O)N2CCC3(CC=CC[C@H]4COCC[C@H]4NC(=O)[C@H](CC(C)C)NC3=O)CC2)cn1 |
| InChI | InChI=1S/C27H39N5O5/c1-18(2)14-22-23(33)30-21-7-13-37-17-19(21)6-4-5-8-27(25(35)31-22)9-11-32(12-10-27)24(34)20-15-28-26(36-3)29-16-20/h4-5,15-16,18-19,21-22H,6-14,17H2,1-3H3,(H,30,33)(H,31,35)/t19-,21+,22-/m0/s1 |
| InChIKey | QJXAKLIHGZSBBC-NNWRFLSQSA-N |
| XLogP | 2.11 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|