C25H33N3O3 — CID 171147697
(3aR,4R,6aS)-4-(2,4-diethoxypyrimidin-5-yl)-2-(2-methyl-3-phenylprop-2-enyl)-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol (PubChem CID 171147697) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is (3aR,4R,6aS)-4-(2,4-diethoxypyrimidin-5-yl)-2-(2-methyl-3-phenylprop-2-enyl)-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol.
| Compound Name | (3aR,4R,6aS)-4-(2,4-diethoxypyrimidin-5-yl)-2-(2-methyl-3-phenylprop-2-enyl)-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol |
|---|---|
| PubChem CID | 171147697 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | (3aR,4R,6aS)-4-(2,4-diethoxypyrimidin-5-yl)-2-(2-methyl-3-phenylprop-2-enyl)-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol |
| SMILES | CCOc1ncc([C@@]2(O)CC[C@@H]3CN(CC(C)=Cc4ccccc4)C[C@@H]32)c(OCC)n1 |
| InChI | InChI=1S/C25H33N3O3/c1-4-30-23-21(14-26-24(27-23)31-5-2)25(29)12-11-20-16-28(17-22(20)25)15-18(3)13-19-9-7-6-8-10-19/h6-10,13-14,20,22,29H,4-5,11-12,15-17H2,1-3H3/t20-,22+,25+/m1/s1 |
| InChIKey | DBPZFCWPPDODIW-KJWPAHLWSA-N |
| XLogP | 3.91 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |