C12H18O5 — CID 171147799
ethyl 2-(8,8-dimethyl-3,7,9-trioxatricyclo[4.3.0.02,4]nonan-2-yl)acetate (PubChem CID 171147799) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is ethyl 2-(8,8-dimethyl-3,7,9-trioxatricyclo[4.3.0.02,4]nonan-2-yl)acetate.
| Compound Name | ethyl 2-(8,8-dimethyl-3,7,9-trioxatricyclo[4.3.0.02,4]nonan-2-yl)acetate |
|---|---|
| PubChem CID | 171147799 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | ethyl 2-(8,8-dimethyl-3,7,9-trioxatricyclo[4.3.0.02,4]nonan-2-yl)acetate |
| SMILES | CCOC(=O)CC12OC1CC1OC(C)(C)OC12 |
| InChI | InChI=1S/C12H18O5/c1-4-14-9(13)6-12-8(16-12)5-7-10(12)17-11(2,3)15-7/h7-8,10H,4-6H2,1-3H3 |
| InChIKey | YERYYLHWWCHIRT-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|