C23H34N2O2 — CID 171148200
(2-ethylphenyl)-[(6R,11R)-11-hydroxy-8-(2-methylbut-2-enyl)-2,8-diazaspiro[5.5]undecan-2-yl]methanone (PubChem CID 171148200) has the molecular formula C23H34N2O2 and a molecular weight of 370.54 g/mol. Its IUPAC name is (2-ethylphenyl)-[(6R,11R)-11-hydroxy-8-(2-methylbut-2-enyl)-2,8-diazaspiro[5.5]undecan-2-yl]methanone.
| Compound Name | (2-ethylphenyl)-[(6R,11R)-11-hydroxy-8-(2-methylbut-2-enyl)-2,8-diazaspiro[5.5]undecan-2-yl]methanone |
|---|---|
| PubChem CID | 171148200 |
| Molecular Formula | C23H34N2O2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | (2-ethylphenyl)-[(6R,11R)-11-hydroxy-8-(2-methylbut-2-enyl)-2,8-diazaspiro[5.5]undecan-2-yl]methanone |
| SMILES | CC=C(C)CN1CC[C@@H](O)[C@]2(CCCN(C(=O)c3ccccc3CC)C2)C1 |
| InChI | InChI=1S/C23H34N2O2/c1-4-18(3)15-24-14-11-21(26)23(16-24)12-8-13-25(17-23)22(27)20-10-7-6-9-19(20)5-2/h4,6-7,9-10,21,26H,5,8,11-17H2,1-3H3/t21-,23-/m1/s1 |
| InChIKey | VSHRVCXEZWZJIY-FYYLOGMGSA-N |
| XLogP | 3.50 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|