C19H24ClN3O3S — CID 171148972
3-[2-[(4-chlorophenyl)methylsulfonyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]-5-propan-2-yl-1,2,4-oxadiazole (PubChem CID 171148972) has the molecular formula C19H24ClN3O3S and a molecular weight of 409.94 g/mol. Its IUPAC name is 3-[2-[(4-chlorophenyl)methylsulfonyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]-5-propan-2-yl-1,2,4-oxadiazole.
| Compound Name | 3-[2-[(4-chlorophenyl)methylsulfonyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]-5-propan-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 171148972 |
| Molecular Formula | C19H24ClN3O3S |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 3-[2-[(4-chlorophenyl)methylsulfonyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]-5-propan-2-yl-1,2,4-oxadiazole |
| SMILES | CC(C)c1nc(C23CCCC2CN(S(=O)(=O)Cc2ccc(Cl)cc2)C3)no1 |
| InChI | InChI=1S/C19H24ClN3O3S/c1-13(2)17-21-18(22-26-17)19-9-3-4-15(19)10-23(12-19)27(24,25)11-14-5-7-16(20)8-6-14/h5-8,13,15H,3-4,9-12H2,1-2H3 |
| InChIKey | SOTYHSGOIRTLBT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |